C18H33NO6 — CID 86647571
ditert-butyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanedioate (PubChem CID 86647571) has the molecular formula C18H33NO6 and a molecular weight of 359.46 g/mol. Its IUPAC name is ditert-butyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanedioate.
| Compound Name | ditert-butyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanedioate |
|---|---|
| PubChem CID | 86647571 |
| Molecular Formula | C18H33NO6 |
| Molecular Weight | 359.46 g/mol |
| Exact Mass | 359.23 |
| IUPAC Name | ditert-butyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanedioate |
| SMILES | CC(C)(C)OC(=O)CC[C@H](NC(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H33NO6/c1-16(2,3)23-13(20)11-10-12(14(21)24-17(4,5)6)19-15(22)25-18(7,8)9/h12H,10-11H2,1-9H3,(H,19,22)/t12-/m0/s1 |
| InChIKey | HGLNOEIXORVIIP-LBPRGKRZSA-N |
| XLogP | 3.34 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.46 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|