C18H33NO8S — CID 89377017
1-O-tert-butyl 5-O-(2-ethylsulfonylethyl) (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanedioate (PubChem CID 89377017) has the molecular formula C18H33NO8S and a molecular weight of 423.53 g/mol. Its IUPAC name is 1-O-tert-butyl 5-O-(2-ethylsulfonylethyl) (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanedioate.
| Compound Name | 1-O-tert-butyl 5-O-(2-ethylsulfonylethyl) (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanedioate |
|---|---|
| PubChem CID | 89377017 |
| Molecular Formula | C18H33NO8S |
| Molecular Weight | 423.53 g/mol |
| Exact Mass | 423.19 |
| IUPAC Name | 1-O-tert-butyl 5-O-(2-ethylsulfonylethyl) (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanedioate |
| SMILES | CCS(=O)(=O)CCOC(=O)CC[C@H](NC(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H33NO8S/c1-8-28(23,24)12-11-25-14(20)10-9-13(15(21)26-17(2,3)4)19-16(22)27-18(5,6)7/h13H,8-12H2,1-7H3,(H,19,22)/t13-/m0/s1 |
| InChIKey | AZLZUZOWGDCOKD-ZDUSSCGKSA-N |
| XLogP | 1.98 |
| TPSA | 125.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.53 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|