C22H37NO10 — CID 11677249
bis(2,2-dimethylpropanoyloxymethyl) (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanedioate (PubChem CID 11677249) has the molecular formula C22H37NO10 and a molecular weight of 475.54 g/mol. Its IUPAC name is bis(2,2-dimethylpropanoyloxymethyl) (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanedioate.
| Compound Name | bis(2,2-dimethylpropanoyloxymethyl) (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanedioate |
|---|---|
| PubChem CID | 11677249 |
| Molecular Formula | C22H37NO10 |
| Molecular Weight | 475.54 g/mol |
| Exact Mass | 475.24 |
| IUPAC Name | bis(2,2-dimethylpropanoyloxymethyl) (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanedioate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCC(=O)OCOC(=O)C(C)(C)C)C(=O)OCOC(=O)C(C)(C)C |
| InChI | InChI=1S/C22H37NO10/c1-20(2,3)17(26)31-12-29-15(24)11-10-14(23-19(28)33-22(7,8)9)16(25)30-13-32-18(27)21(4,5)6/h14H,10-13H2,1-9H3,(H,23,28)/t14-/m0/s1 |
| InChIKey | NEASKSKTBRIPIY-AWEZNQCLSA-N |
| XLogP | 2.84 |
| TPSA | 143.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.54 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|