C18H32N2O7 — CID 88935058
5-O-(2-acetamidoethyl) 1-O-tert-butyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanedioate (PubChem CID 88935058) has the molecular formula C18H32N2O7 and a molecular weight of 388.46 g/mol. Its IUPAC name is 5-O-(2-acetamidoethyl) 1-O-tert-butyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanedioate.
| Compound Name | 5-O-(2-acetamidoethyl) 1-O-tert-butyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanedioate |
|---|---|
| PubChem CID | 88935058 |
| Molecular Formula | C18H32N2O7 |
| Molecular Weight | 388.46 g/mol |
| Exact Mass | 388.22 |
| IUPAC Name | 5-O-(2-acetamidoethyl) 1-O-tert-butyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanedioate |
| SMILES | CC(=O)NCCOC(=O)CC[C@H](NC(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H32N2O7/c1-12(21)19-10-11-25-14(22)9-8-13(15(23)26-17(2,3)4)20-16(24)27-18(5,6)7/h13H,8-11H2,1-7H3,(H,19,21)(H,20,24)/t13-/m0/s1 |
| InChIKey | MFHFZJRVGMKHML-ZDUSSCGKSA-N |
| XLogP | 1.68 |
| TPSA | 120.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.46 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|