C22H32N2O7 — CID 59903928
5-O-(4-acetamidophenyl) 1-O-tert-butyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanedioate (PubChem CID 59903928) has the molecular formula C22H32N2O7 and a molecular weight of 436.51 g/mol. Its IUPAC name is 5-O-(4-acetamidophenyl) 1-O-tert-butyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanedioate.
| Compound Name | 5-O-(4-acetamidophenyl) 1-O-tert-butyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanedioate |
|---|---|
| PubChem CID | 59903928 |
| Molecular Formula | C22H32N2O7 |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.22 |
| IUPAC Name | 5-O-(4-acetamidophenyl) 1-O-tert-butyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanedioate |
| SMILES | CC(=O)Nc1ccc(OC(=O)CCC(NC(=O)OC(C)(C)C)C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C22H32N2O7/c1-14(25)23-15-8-10-16(11-9-15)29-18(26)13-12-17(19(27)30-21(2,3)4)24-20(28)31-22(5,6)7/h8-11,17H,12-13H2,1-7H3,(H,23,25)(H,24,28) |
| InChIKey | ABPKWZLHVDDYNS-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 120.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|