C26H33NO6 — CID 90955617
bis(4-ethylphenyl) (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanedioate (PubChem CID 90955617) has the molecular formula C26H33NO6 and a molecular weight of 455.55 g/mol. Its IUPAC name is bis(4-ethylphenyl) (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanedioate.
| Compound Name | bis(4-ethylphenyl) (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanedioate |
|---|---|
| PubChem CID | 90955617 |
| Molecular Formula | C26H33NO6 |
| Molecular Weight | 455.55 g/mol |
| Exact Mass | 455.23 |
| IUPAC Name | bis(4-ethylphenyl) (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanedioate |
| SMILES | CCc1ccc(OC(=O)CC[C@H](NC(=O)OC(C)(C)C)C(=O)Oc2ccc(CC)cc2)cc1 |
| InChI | InChI=1S/C26H33NO6/c1-6-18-8-12-20(13-9-18)31-23(28)17-16-22(27-25(30)33-26(3,4)5)24(29)32-21-14-10-19(7-2)11-15-21/h8-15,22H,6-7,16-17H2,1-5H3,(H,27,30)/t22-/m0/s1 |
| InChIKey | DROHKRZDGDSXIR-QFIPXVFZSA-N |
| XLogP | 5.00 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.55 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|