C18H26N2O5S — CID 66916750
(4-acetamidophenyl) (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-methylsulfanylbutanoate (PubChem CID 66916750) has the molecular formula C18H26N2O5S and a molecular weight of 382.48 g/mol. Its IUPAC name is (4-acetamidophenyl) (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-methylsulfanylbutanoate.
| Compound Name | (4-acetamidophenyl) (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 66916750 |
| Molecular Formula | C18H26N2O5S |
| Molecular Weight | 382.48 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | (4-acetamidophenyl) (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-methylsulfanylbutanoate |
| SMILES | CSCC[C@H](NC(=O)OC(C)(C)C)C(=O)Oc1ccc(NC(C)=O)cc1 |
| InChI | InChI=1S/C18H26N2O5S/c1-12(21)19-13-6-8-14(9-7-13)24-16(22)15(10-11-26-5)20-17(23)25-18(2,3)4/h6-9,15H,10-11H2,1-5H3,(H,19,21)(H,20,23)/t15-/m0/s1 |
| InChIKey | WEHNPAWYTRATCZ-HNNXBMFYSA-N |
| XLogP | 3.20 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.48 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|