C16H23ClN2O3S — CID 10937249
tert-butyl N-[(2S)-1-(3-chloroanilino)-4-methylsulfanyl-1-oxobutan-2-yl]carbamate (PubChem CID 10937249) has the molecular formula C16H23ClN2O3S and a molecular weight of 358.89 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-(3-chloroanilino)-4-methylsulfanyl-1-oxobutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-(3-chloroanilino)-4-methylsulfanyl-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 10937249 |
| Molecular Formula | C16H23ClN2O3S |
| Molecular Weight | 358.89 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | tert-butyl N-[(2S)-1-(3-chloroanilino)-4-methylsulfanyl-1-oxobutan-2-yl]carbamate |
| SMILES | CSCC[C@H](NC(=O)OC(C)(C)C)C(=O)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C16H23ClN2O3S/c1-16(2,3)22-15(21)19-13(8-9-23-4)14(20)18-12-7-5-6-11(17)10-12/h5-7,10,13H,8-9H2,1-4H3,(H,18,20)(H,19,21)/t13-/m0/s1 |
| InChIKey | ZSVXKYIIHAVGFE-ZDUSSCGKSA-N |
| XLogP | 3.92 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.89 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |