C16H22BrNO3S — CID 139886096
tert-butyl N-[(2S)-1-(3-bromophenyl)-4-methylsulfanyl-1-oxobutan-2-yl]carbamate (PubChem CID 139886096) has the molecular formula C16H22BrNO3S and a molecular weight of 388.33 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-(3-bromophenyl)-4-methylsulfanyl-1-oxobutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-(3-bromophenyl)-4-methylsulfanyl-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 139886096 |
| Molecular Formula | C16H22BrNO3S |
| Molecular Weight | 388.33 g/mol |
| Exact Mass | 387.05 |
| IUPAC Name | tert-butyl N-[(2S)-1-(3-bromophenyl)-4-methylsulfanyl-1-oxobutan-2-yl]carbamate |
| SMILES | CSCC[C@H](NC(=O)OC(C)(C)C)C(=O)c1cccc(Br)c1 |
| InChI | InChI=1S/C16H22BrNO3S/c1-16(2,3)21-15(20)18-13(8-9-22-4)14(19)11-6-5-7-12(17)10-11/h5-7,10,13H,8-9H2,1-4H3,(H,18,20)/t13-/m0/s1 |
| InChIKey | AXWISLTYZNIUHQ-ZDUSSCGKSA-N |
| XLogP | 4.28 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.33 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |