C17H26ClIN2O3S — CID 11027506
[(3S)-4-(3-chloroanilino)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutyl]-dimethylsulfanium iodide (PubChem CID 11027506) has the molecular formula C17H26ClIN2O3S and a molecular weight of 500.83 g/mol. Its IUPAC name is [(3S)-4-(3-chloroanilino)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutyl]-dimethylsulfanium iodide.
| Compound Name | [(3S)-4-(3-chloroanilino)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutyl]-dimethylsulfanium iodide |
|---|---|
| PubChem CID | 11027506 |
| Molecular Formula | C17H26ClIN2O3S |
| Molecular Weight | 500.83 g/mol |
| Exact Mass | 500.04 |
| IUPAC Name | [(3S)-4-(3-chloroanilino)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutyl]-dimethylsulfanium iodide |
| SMILES | C[S+](C)CC[C@H](NC(=O)OC(C)(C)C)C(=O)Nc1cccc(Cl)c1.[I-] |
| InChI | InChI=1S/C17H25ClN2O3S.HI/c1-17(2,3)23-16(22)20-14(9-10-24(4)5)15(21)19-13-8-6-7-12(18)11-13;/h6-8,11,14H,9-10H2,1-5H3,(H-,19,20,21,22);1H/t14-;/m0./s1 |
| InChIKey | JQGPJAOYXJLHOM-UQKRIMTDSA-N |
| XLogP | 0.44 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.83 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|