C27H43N2O4SSi+ — CID 11006784
[(3S)-4-[[7-[tert-butyl(dimethyl)silyl]oxynaphthalen-1-yl]amino]-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutyl]-dimethylsulfanium (PubChem CID 11006784) has the molecular formula C27H43N2O4SSi+ and a molecular weight of 519.80 g/mol. Its IUPAC name is [(3S)-4-[[7-[tert-butyl(dimethyl)silyl]oxynaphthalen-1-yl]amino]-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutyl]-dimethylsulfanium.
| Compound Name | [(3S)-4-[[7-[tert-butyl(dimethyl)silyl]oxynaphthalen-1-yl]amino]-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutyl]-dimethylsulfanium |
|---|---|
| PubChem CID | 11006784 |
| Molecular Formula | C27H43N2O4SSi+ |
| Molecular Weight | 519.80 g/mol |
| Exact Mass | 519.27 |
| IUPAC Name | [(3S)-4-[[7-[tert-butyl(dimethyl)silyl]oxynaphthalen-1-yl]amino]-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutyl]-dimethylsulfanium |
| SMILES | C[S+](C)CC[C@H](NC(=O)OC(C)(C)C)C(=O)Nc1cccc2ccc(O[Si](C)(C)C(C)(C)C)cc12 |
| InChI | InChI=1S/C27H42N2O4SSi/c1-26(2,3)32-25(31)29-23(16-17-34(7)8)24(30)28-22-13-11-12-19-14-15-20(18-21(19)22)33-35(9,10)27(4,5)6/h11-15,18,23H,16-17H2,1-10H3,(H-,28,29,30,31)/p+1/t23-/m0/s1 |
| InChIKey | KLUBDKMOBWHLDS-QHCPKHFHSA-O |
| XLogP | 6.32 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.80 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|