C19H31IN2O3S — CID 10962050
dimethyl-[(3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxo-4-(2-phenylethylamino)butyl]sulfanium iodide (PubChem CID 10962050) has the molecular formula C19H31IN2O3S and a molecular weight of 494.44 g/mol. Its IUPAC name is dimethyl-[(3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxo-4-(2-phenylethylamino)butyl]sulfanium iodide.
| Compound Name | dimethyl-[(3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxo-4-(2-phenylethylamino)butyl]sulfanium iodide |
|---|---|
| PubChem CID | 10962050 |
| Molecular Formula | C19H31IN2O3S |
| Molecular Weight | 494.44 g/mol |
| Exact Mass | 494.11 |
| IUPAC Name | dimethyl-[(3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxo-4-(2-phenylethylamino)butyl]sulfanium iodide |
| SMILES | C[S+](C)CC[C@H](NC(=O)OC(C)(C)C)C(=O)NCCc1ccccc1.[I-] |
| InChI | InChI=1S/C19H30N2O3S.HI/c1-19(2,3)24-18(23)21-16(12-14-25(4)5)17(22)20-13-11-15-9-7-6-8-10-15;/h6-10,16H,11-14H2,1-5H3,(H-,20,21,22,23);1H/t16-;/m0./s1 |
| InChIKey | MGOSEPAKPGFHSK-NTISSMGPSA-N |
| XLogP | -0.49 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.44 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|