C19H31N2O3S+ — CID 11092235
dimethyl-[(3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxo-4-(2-phenylethylamino)butyl]sulfanium (PubChem CID 11092235) has the molecular formula C19H31N2O3S+ and a molecular weight of 367.54 g/mol. Its IUPAC name is dimethyl-[(3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxo-4-(2-phenylethylamino)butyl]sulfanium.
| Compound Name | dimethyl-[(3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxo-4-(2-phenylethylamino)butyl]sulfanium |
|---|---|
| PubChem CID | 11092235 |
| Molecular Formula | C19H31N2O3S+ |
| Molecular Weight | 367.54 g/mol |
| Exact Mass | 367.20 |
| IUPAC Name | dimethyl-[(3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxo-4-(2-phenylethylamino)butyl]sulfanium |
| SMILES | C[S+](C)CC[C@@H](NC(=O)OC(C)(C)C)C(=O)NCCc1ccccc1 |
| InChI | InChI=1S/C19H30N2O3S/c1-19(2,3)24-18(23)21-16(12-14-25(4)5)17(22)20-13-11-15-9-7-6-8-10-15/h6-10,16H,11-14H2,1-5H3,(H-,20,21,22,23)/p+1/t16-/m1/s1 |
| InChIKey | DKYCSRMIYAJZOO-MRXNPFEDSA-O |
| XLogP | 2.51 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.54 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|