C23H38N2O3 — CID 123530299
tert-butyl N-[1-(octylamino)-1-oxo-4-phenylbutan-2-yl]carbamate (PubChem CID 123530299) has the molecular formula C23H38N2O3 and a molecular weight of 390.57 g/mol. Its IUPAC name is tert-butyl N-[1-(octylamino)-1-oxo-4-phenylbutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-(octylamino)-1-oxo-4-phenylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 123530299 |
| Molecular Formula | C23H38N2O3 |
| Molecular Weight | 390.57 g/mol |
| Exact Mass | 390.29 |
| IUPAC Name | tert-butyl N-[1-(octylamino)-1-oxo-4-phenylbutan-2-yl]carbamate |
| SMILES | CCCCCCCCNC(=O)C(CCc1ccccc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H38N2O3/c1-5-6-7-8-9-13-18-24-21(26)20(25-22(27)28-23(2,3)4)17-16-19-14-11-10-12-15-19/h10-12,14-15,20H,5-9,13,16-18H2,1-4H3,(H,24,26)(H,25,27) |
| InChIKey | MEQHKBVNBONKIC-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.57 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|