C31H41N3O9 — CID 18476946
2-[4-[2-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoyl]amino]-3-oxo-3-(pentylamino)propyl]phenoxy]propanedioic acid (PubChem CID 18476946) has the molecular formula C31H41N3O9 and a molecular weight of 599.68 g/mol. Its IUPAC name is 2-[4-[2-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoyl]amino]-3-oxo-3-(pentylamino)propyl]phenoxy]propanedioic acid.
| Compound Name | 2-[4-[2-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoyl]amino]-3-oxo-3-(pentylamino)propyl]phenoxy]propanedioic acid |
|---|---|
| PubChem CID | 18476946 |
| Molecular Formula | C31H41N3O9 |
| Molecular Weight | 599.68 g/mol |
| Exact Mass | 599.28 |
| IUPAC Name | 2-[4-[2-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoyl]amino]-3-oxo-3-(pentylamino)propyl]phenoxy]propanedioic acid |
| SMILES | CCCCCNC(=O)C(Cc1ccc(OC(C(=O)O)C(=O)O)cc1)NC(=O)C(Cc1ccccc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C31H41N3O9/c1-5-6-10-17-32-26(35)23(19-21-13-15-22(16-14-21)42-25(28(37)38)29(39)40)33-27(36)24(18-20-11-8-7-9-12-20)34-30(41)43-31(2,3)4/h7-9,11-16,23-25H,5-6,10,17-19H2,1-4H3,(H,32,35)(H,33,36)(H,34,41)(H,37,38)(H,39,40) |
| InChIKey | JOEKHKWIRSFSGG-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 180.36 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.68 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|