C32H43N3O10 — CID 10865108
2-[4-[(2S)-2-[[(2S)-3-(4-methoxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]-3-oxo-3-(pentylamino)propyl]phenoxy]propanedioic acid (PubChem CID 10865108) has the molecular formula C32H43N3O10 and a molecular weight of 629.71 g/mol. Its IUPAC name is 2-[4-[(2S)-2-[[(2S)-3-(4-methoxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]-3-oxo-3-(pentylamino)propyl]phenoxy]propanedioic acid.
| Compound Name | 2-[4-[(2S)-2-[[(2S)-3-(4-methoxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]-3-oxo-3-(pentylamino)propyl]phenoxy]propanedioic acid |
|---|---|
| PubChem CID | 10865108 |
| Molecular Formula | C32H43N3O10 |
| Molecular Weight | 629.71 g/mol |
| Exact Mass | 629.29 |
| IUPAC Name | 2-[4-[(2S)-2-[[(2S)-3-(4-methoxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]-3-oxo-3-(pentylamino)propyl]phenoxy]propanedioic acid |
| SMILES | CCCCCNC(=O)[C@H](Cc1ccc(OC(C(=O)O)C(=O)O)cc1)NC(=O)[C@H](Cc1ccc(OC)cc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C32H43N3O10/c1-6-7-8-17-33-27(36)24(18-21-11-15-23(16-12-21)44-26(29(38)39)30(40)41)34-28(37)25(35-31(42)45-32(2,3)4)19-20-9-13-22(43-5)14-10-20/h9-16,24-26H,6-8,17-19H2,1-5H3,(H,33,36)(H,34,37)(H,35,42)(H,38,39)(H,40,41)/t24-,25-/m0/s1 |
| InChIKey | UAIBALKKMJGUMP-DQEYMECFSA-N |
| XLogP | 3.08 |
| TPSA | 189.59 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.71 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|