C32H47N3O10 — CID 22951760
tert-butyl N-[1-[[3-[4-(1,3-dihydroperoxypropan-2-yloxy)phenyl]-1-oxo-1-(pentylamino)propan-2-yl]amino]-3-(4-methoxyphenyl)-1-oxopropan-2-yl]carbamate (PubChem CID 22951760) has the molecular formula C32H47N3O10 and a molecular weight of 633.74 g/mol. Its IUPAC name is tert-butyl N-[1-[[3-[4-(1,3-dihydroperoxypropan-2-yloxy)phenyl]-1-oxo-1-(pentylamino)propan-2-yl]amino]-3-(4-methoxyphenyl)-1-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[[3-[4-(1,3-dihydroperoxypropan-2-yloxy)phenyl]-1-oxo-1-(pentylamino)propan-2-yl]amino]-3-(4-methoxyphenyl)-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 22951760 |
| Molecular Formula | C32H47N3O10 |
| Molecular Weight | 633.74 g/mol |
| Exact Mass | 633.33 |
| IUPAC Name | tert-butyl N-[1-[[3-[4-(1,3-dihydroperoxypropan-2-yloxy)phenyl]-1-oxo-1-(pentylamino)propan-2-yl]amino]-3-(4-methoxyphenyl)-1-oxopropan-2-yl]carbamate |
| SMILES | CCCCCNC(=O)C(Cc1ccc(OC(COO)COO)cc1)NC(=O)C(Cc1ccc(OC)cc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C32H47N3O10/c1-6-7-8-17-33-29(36)27(18-23-11-15-25(16-12-23)44-26(20-42-39)21-43-40)34-30(37)28(35-31(38)45-32(2,3)4)19-22-9-13-24(41-5)14-10-22/h9-16,26-28,39-40H,6-8,17-21H2,1-5H3,(H,33,36)(H,34,37)(H,35,38) |
| InChIKey | QUTJPCPSQZBSOZ-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 173.91 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.74 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|