C21H34N2O7 — CID 22951749
N-[3-[4-(1,3-dihydroperoxypropan-2-yloxy)phenyl]-1-oxo-1-(pentylamino)propan-2-yl]butanamide (PubChem CID 22951749) has the molecular formula C21H34N2O7 and a molecular weight of 426.51 g/mol. Its IUPAC name is N-[3-[4-(1,3-dihydroperoxypropan-2-yloxy)phenyl]-1-oxo-1-(pentylamino)propan-2-yl]butanamide.
| Compound Name | N-[3-[4-(1,3-dihydroperoxypropan-2-yloxy)phenyl]-1-oxo-1-(pentylamino)propan-2-yl]butanamide |
|---|---|
| PubChem CID | 22951749 |
| Molecular Formula | C21H34N2O7 |
| Molecular Weight | 426.51 g/mol |
| Exact Mass | 426.24 |
| IUPAC Name | N-[3-[4-(1,3-dihydroperoxypropan-2-yloxy)phenyl]-1-oxo-1-(pentylamino)propan-2-yl]butanamide |
| SMILES | CCCCCNC(=O)C(Cc1ccc(OC(COO)COO)cc1)NC(=O)CCC |
| InChI | InChI=1S/C21H34N2O7/c1-3-5-6-12-22-21(25)19(23-20(24)7-4-2)13-16-8-10-17(11-9-16)30-18(14-28-26)15-29-27/h8-11,18-19,26-27H,3-7,12-15H2,1-2H3,(H,22,25)(H,23,24) |
| InChIKey | OXQHAFDJXGLIIN-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 126.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.51 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|