C21H29N3O8 — CID 18476941
2-[4-[2-[(4-amino-4-oxobutanoyl)amino]-3-oxo-3-(pentylamino)propyl]phenoxy]propanedioic acid (PubChem CID 18476941) has the molecular formula C21H29N3O8 and a molecular weight of 451.48 g/mol. Its IUPAC name is 2-[4-[2-[(4-amino-4-oxobutanoyl)amino]-3-oxo-3-(pentylamino)propyl]phenoxy]propanedioic acid.
| Compound Name | 2-[4-[2-[(4-amino-4-oxobutanoyl)amino]-3-oxo-3-(pentylamino)propyl]phenoxy]propanedioic acid |
|---|---|
| PubChem CID | 18476941 |
| Molecular Formula | C21H29N3O8 |
| Molecular Weight | 451.48 g/mol |
| Exact Mass | 451.20 |
| IUPAC Name | 2-[4-[2-[(4-amino-4-oxobutanoyl)amino]-3-oxo-3-(pentylamino)propyl]phenoxy]propanedioic acid |
| SMILES | CCCCCNC(=O)C(Cc1ccc(OC(C(=O)O)C(=O)O)cc1)NC(=O)CCC(N)=O |
| InChI | InChI=1S/C21H29N3O8/c1-2-3-4-11-23-19(27)15(24-17(26)10-9-16(22)25)12-13-5-7-14(8-6-13)32-18(20(28)29)21(30)31/h5-8,15,18H,2-4,9-12H2,1H3,(H2,22,25)(H,23,27)(H,24,26)(H,28,29)(H,30,31) |
| InChIKey | MRRAONMIFSJJOW-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 185.12 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.48 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|