C41H44N2O9 — CID 10919597
dibenzyl 2-[4-[(2S)-3-(butylamino)-3-oxo-2-[(4-oxo-4-phenylmethoxybutanoyl)amino]propyl]phenoxy]propanedioate (PubChem CID 10919597) has the molecular formula C41H44N2O9 and a molecular weight of 708.81 g/mol. Its IUPAC name is dibenzyl 2-[4-[(2S)-3-(butylamino)-3-oxo-2-[(4-oxo-4-phenylmethoxybutanoyl)amino]propyl]phenoxy]propanedioate.
| Compound Name | dibenzyl 2-[4-[(2S)-3-(butylamino)-3-oxo-2-[(4-oxo-4-phenylmethoxybutanoyl)amino]propyl]phenoxy]propanedioate |
|---|---|
| PubChem CID | 10919597 |
| Molecular Formula | C41H44N2O9 |
| Molecular Weight | 708.81 g/mol |
| Exact Mass | 708.30 |
| IUPAC Name | dibenzyl 2-[4-[(2S)-3-(butylamino)-3-oxo-2-[(4-oxo-4-phenylmethoxybutanoyl)amino]propyl]phenoxy]propanedioate |
| SMILES | CCCCNC(=O)[C@H](Cc1ccc(OC(C(=O)OCc2ccccc2)C(=O)OCc2ccccc2)cc1)NC(=O)CCC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C41H44N2O9/c1-2-3-25-42-39(46)35(43-36(44)23-24-37(45)49-27-31-13-7-4-8-14-31)26-30-19-21-34(22-20-30)52-38(40(47)50-28-32-15-9-5-10-16-32)41(48)51-29-33-17-11-6-12-18-33/h4-22,35,38H,2-3,23-29H2,1H3,(H,42,46)(H,43,44)/t35-/m0/s1 |
| InChIKey | LMKFJKUEHRPNMH-DHUJRADRSA-N |
| XLogP | 5.39 |
| TPSA | 146.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.81 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|