C36H43N3O8 — CID 59878946
dibenzyl 2-[4-[(2S)-2-[[(2S)-2-amino-4-oxopentanoyl]amino]-3-oxo-3-(pentylamino)propyl]phenoxy]propanedioate (PubChem CID 59878946) has the molecular formula C36H43N3O8 and a molecular weight of 645.75 g/mol. Its IUPAC name is dibenzyl 2-[4-[(2S)-2-[[(2S)-2-amino-4-oxopentanoyl]amino]-3-oxo-3-(pentylamino)propyl]phenoxy]propanedioate.
| Compound Name | dibenzyl 2-[4-[(2S)-2-[[(2S)-2-amino-4-oxopentanoyl]amino]-3-oxo-3-(pentylamino)propyl]phenoxy]propanedioate |
|---|---|
| PubChem CID | 59878946 |
| Molecular Formula | C36H43N3O8 |
| Molecular Weight | 645.75 g/mol |
| Exact Mass | 645.31 |
| IUPAC Name | dibenzyl 2-[4-[(2S)-2-[[(2S)-2-amino-4-oxopentanoyl]amino]-3-oxo-3-(pentylamino)propyl]phenoxy]propanedioate |
| SMILES | CCCCCNC(=O)[C@H](Cc1ccc(OC(C(=O)OCc2ccccc2)C(=O)OCc2ccccc2)cc1)NC(=O)[C@@H](N)CC(C)=O |
| InChI | InChI=1S/C36H43N3O8/c1-3-4-11-20-38-34(42)31(39-33(41)30(37)21-25(2)40)22-26-16-18-29(19-17-26)47-32(35(43)45-23-27-12-7-5-8-13-27)36(44)46-24-28-14-9-6-10-15-28/h5-10,12-19,30-32H,3-4,11,20-24,37H2,1-2H3,(H,38,42)(H,39,41)/t30-,31-/m0/s1 |
| InChIKey | ARILPIOPNVKXIB-CONSDPRKSA-N |
| XLogP | 3.56 |
| TPSA | 163.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.75 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|