C35H49N3O9 — CID 11050595
diethyl 2-[4-[(2S)-2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoyl]amino]-3-oxo-3-(pentylamino)propyl]phenoxy]propanedioate (PubChem CID 11050595) has the molecular formula C35H49N3O9 and a molecular weight of 655.79 g/mol. Its IUPAC name is diethyl 2-[4-[(2S)-2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoyl]amino]-3-oxo-3-(pentylamino)propyl]phenoxy]propanedioate.
| Compound Name | diethyl 2-[4-[(2S)-2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoyl]amino]-3-oxo-3-(pentylamino)propyl]phenoxy]propanedioate |
|---|---|
| PubChem CID | 11050595 |
| Molecular Formula | C35H49N3O9 |
| Molecular Weight | 655.79 g/mol |
| Exact Mass | 655.35 |
| IUPAC Name | diethyl 2-[4-[(2S)-2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoyl]amino]-3-oxo-3-(pentylamino)propyl]phenoxy]propanedioate |
| SMILES | CCCCCNC(=O)[C@H](Cc1ccc(OC(C(=O)OCC)C(=O)OCC)cc1)NC(=O)[C@H](Cc1ccccc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C35H49N3O9/c1-7-10-14-21-36-30(39)27(23-25-17-19-26(20-18-25)46-29(32(41)44-8-2)33(42)45-9-3)37-31(40)28(22-24-15-12-11-13-16-24)38-34(43)47-35(4,5)6/h11-13,15-20,27-29H,7-10,14,21-23H2,1-6H3,(H,36,39)(H,37,40)(H,38,43)/t27-,28-/m0/s1 |
| InChIKey | NBXNPVTXOLSETM-NSOVKSMOSA-N |
| XLogP | 4.03 |
| TPSA | 158.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.79 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|