C31H45N3O10 — CID 22951759
tert-butyl N-[1-[[3-[4-(1,3-dihydroperoxypropan-2-yloxy)phenyl]-1-oxo-1-(pentylamino)propan-2-yl]amino]-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]carbamate (PubChem CID 22951759) has the molecular formula C31H45N3O10 and a molecular weight of 619.71 g/mol. Its IUPAC name is tert-butyl N-[1-[[3-[4-(1,3-dihydroperoxypropan-2-yloxy)phenyl]-1-oxo-1-(pentylamino)propan-2-yl]amino]-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[[3-[4-(1,3-dihydroperoxypropan-2-yloxy)phenyl]-1-oxo-1-(pentylamino)propan-2-yl]amino]-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 22951759 |
| Molecular Formula | C31H45N3O10 |
| Molecular Weight | 619.71 g/mol |
| Exact Mass | 619.31 |
| IUPAC Name | tert-butyl N-[1-[[3-[4-(1,3-dihydroperoxypropan-2-yloxy)phenyl]-1-oxo-1-(pentylamino)propan-2-yl]amino]-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]carbamate |
| SMILES | CCCCCNC(=O)C(Cc1ccc(OC(COO)COO)cc1)NC(=O)C(Cc1ccc(O)cc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C31H45N3O10/c1-5-6-7-16-32-28(36)26(17-22-10-14-24(15-11-22)43-25(19-41-39)20-42-40)33-29(37)27(34-30(38)44-31(2,3)4)18-21-8-12-23(35)13-9-21/h8-15,25-27,35,39-40H,5-7,16-20H2,1-4H3,(H,32,36)(H,33,37)(H,34,38) |
| InChIKey | XCHWOLOAOGUCAT-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 184.91 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.71 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|