C27H45N3O10S — CID 22951765
tert-butyl N-[1-[[3-[4-(1,3-dihydroperoxypropan-2-yloxy)phenyl]-1-oxo-1-(pentylamino)propan-2-yl]amino]-4-methylsulfinyl-1-oxobutan-2-yl]carbamate (PubChem CID 22951765) has the molecular formula C27H45N3O10S and a molecular weight of 603.74 g/mol. Its IUPAC name is tert-butyl N-[1-[[3-[4-(1,3-dihydroperoxypropan-2-yloxy)phenyl]-1-oxo-1-(pentylamino)propan-2-yl]amino]-4-methylsulfinyl-1-oxobutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[[3-[4-(1,3-dihydroperoxypropan-2-yloxy)phenyl]-1-oxo-1-(pentylamino)propan-2-yl]amino]-4-methylsulfinyl-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 22951765 |
| Molecular Formula | C27H45N3O10S |
| Molecular Weight | 603.74 g/mol |
| Exact Mass | 603.28 |
| IUPAC Name | tert-butyl N-[1-[[3-[4-(1,3-dihydroperoxypropan-2-yloxy)phenyl]-1-oxo-1-(pentylamino)propan-2-yl]amino]-4-methylsulfinyl-1-oxobutan-2-yl]carbamate |
| SMILES | CCCCCNC(=O)C(Cc1ccc(OC(COO)COO)cc1)NC(=O)C(CCS(C)=O)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C27H45N3O10S/c1-6-7-8-14-28-24(31)23(16-19-9-11-20(12-10-19)39-21(17-37-34)18-38-35)29-25(32)22(13-15-41(5)36)30-26(33)40-27(2,3)4/h9-12,21-23,34-35H,6-8,13-18H2,1-5H3,(H,28,31)(H,29,32)(H,30,33) |
| InChIKey | UHARQRPLBNUFFB-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 181.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.74 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|