C37H47N3O11 — CID 22951662
4-[[1-[[3-[4-(1,3-dihydroperoxypropan-2-yloxy)phenyl]-1-oxo-1-(pentylamino)propan-2-yl]amino]-1-oxo-3-(4-phenylmethoxyphenyl)propan-2-yl]amino]-4-oxobutanoic acid (PubChem CID 22951662) has the molecular formula C37H47N3O11 and a molecular weight of 709.79 g/mol. Its IUPAC name is 4-[[1-[[3-[4-(1,3-dihydroperoxypropan-2-yloxy)phenyl]-1-oxo-1-(pentylamino)propan-2-yl]amino]-1-oxo-3-(4-phenylmethoxyphenyl)propan-2-yl]amino]-4-oxobutanoic acid.
| Compound Name | 4-[[1-[[3-[4-(1,3-dihydroperoxypropan-2-yloxy)phenyl]-1-oxo-1-(pentylamino)propan-2-yl]amino]-1-oxo-3-(4-phenylmethoxyphenyl)propan-2-yl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 22951662 |
| Molecular Formula | C37H47N3O11 |
| Molecular Weight | 709.79 g/mol |
| Exact Mass | 709.32 |
| IUPAC Name | 4-[[1-[[3-[4-(1,3-dihydroperoxypropan-2-yloxy)phenyl]-1-oxo-1-(pentylamino)propan-2-yl]amino]-1-oxo-3-(4-phenylmethoxyphenyl)propan-2-yl]amino]-4-oxobutanoic acid |
| SMILES | CCCCCNC(=O)C(Cc1ccc(OC(COO)COO)cc1)NC(=O)C(Cc1ccc(OCc2ccccc2)cc1)NC(=O)CCC(=O)O |
| InChI | InChI=1S/C37H47N3O11/c1-2-3-7-20-38-36(44)32(21-27-12-16-30(17-13-27)51-31(24-49-46)25-50-47)40-37(45)33(39-34(41)18-19-35(42)43)22-26-10-14-29(15-11-26)48-23-28-8-5-4-6-9-28/h4-6,8-17,31-33,46-47H,2-3,7,18-25H2,1H3,(H,38,44)(H,39,41)(H,40,45)(H,42,43) |
| InChIKey | GAWFQTRFDIAEMZ-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 201.98 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.79 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|