C24H30N2O10 — CID 22951651
4-[[3-[4-(1,3-dihydroperoxypropan-2-yloxy)phenyl]-1-oxo-1-(2-phenoxyethylamino)propan-2-yl]amino]-4-oxobutanoic acid (PubChem CID 22951651) has the molecular formula C24H30N2O10 and a molecular weight of 506.51 g/mol. Its IUPAC name is 4-[[3-[4-(1,3-dihydroperoxypropan-2-yloxy)phenyl]-1-oxo-1-(2-phenoxyethylamino)propan-2-yl]amino]-4-oxobutanoic acid.
| Compound Name | 4-[[3-[4-(1,3-dihydroperoxypropan-2-yloxy)phenyl]-1-oxo-1-(2-phenoxyethylamino)propan-2-yl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 22951651 |
| Molecular Formula | C24H30N2O10 |
| Molecular Weight | 506.51 g/mol |
| Exact Mass | 506.19 |
| IUPAC Name | 4-[[3-[4-(1,3-dihydroperoxypropan-2-yloxy)phenyl]-1-oxo-1-(2-phenoxyethylamino)propan-2-yl]amino]-4-oxobutanoic acid |
| SMILES | O=C(O)CCC(=O)NC(Cc1ccc(OC(COO)COO)cc1)C(=O)NCCOc1ccccc1 |
| InChI | InChI=1S/C24H30N2O10/c27-22(10-11-23(28)29)26-21(24(30)25-12-13-33-18-4-2-1-3-5-18)14-17-6-8-19(9-7-17)36-20(15-34-31)16-35-32/h1-9,20-21,31-32H,10-16H2,(H,25,30)(H,26,27)(H,28,29) |
| InChIKey | YHWORMQOXFTXTL-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 172.88 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.51 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|