C22H30N2O10 — CID 18476927
2-[4-[2-(3-carboxypropanoylamino)-3-[(1-hydroxy-4-methylpentan-2-yl)amino]-3-oxopropyl]phenoxy]propanedioic acid (PubChem CID 18476927) has the molecular formula C22H30N2O10 and a molecular weight of 482.49 g/mol. Its IUPAC name is 2-[4-[2-(3-carboxypropanoylamino)-3-[(1-hydroxy-4-methylpentan-2-yl)amino]-3-oxopropyl]phenoxy]propanedioic acid.
| Compound Name | 2-[4-[2-(3-carboxypropanoylamino)-3-[(1-hydroxy-4-methylpentan-2-yl)amino]-3-oxopropyl]phenoxy]propanedioic acid |
|---|---|
| PubChem CID | 18476927 |
| Molecular Formula | C22H30N2O10 |
| Molecular Weight | 482.49 g/mol |
| Exact Mass | 482.19 |
| IUPAC Name | 2-[4-[2-(3-carboxypropanoylamino)-3-[(1-hydroxy-4-methylpentan-2-yl)amino]-3-oxopropyl]phenoxy]propanedioic acid |
| SMILES | CC(C)CC(CO)NC(=O)C(Cc1ccc(OC(C(=O)O)C(=O)O)cc1)NC(=O)CCC(=O)O |
| InChI | InChI=1S/C22H30N2O10/c1-12(2)9-14(11-25)23-20(29)16(24-17(26)7-8-18(27)28)10-13-3-5-15(6-4-13)34-19(21(30)31)22(32)33/h3-6,12,14,16,19,25H,7-11H2,1-2H3,(H,23,29)(H,24,26)(H,27,28)(H,30,31)(H,32,33) |
| InChIKey | ZYBMPHYTMWABDK-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 199.56 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.49 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|