C28H34N2O9 — CID 10929612
2-[4-[(2S)-3-oxo-2-[(4-oxo-4-phenylmethoxybutanoyl)amino]-3-(pentylamino)propyl]phenoxy]propanedioic acid (PubChem CID 10929612) has the molecular formula C28H34N2O9 and a molecular weight of 542.59 g/mol. Its IUPAC name is 2-[4-[(2S)-3-oxo-2-[(4-oxo-4-phenylmethoxybutanoyl)amino]-3-(pentylamino)propyl]phenoxy]propanedioic acid.
| Compound Name | 2-[4-[(2S)-3-oxo-2-[(4-oxo-4-phenylmethoxybutanoyl)amino]-3-(pentylamino)propyl]phenoxy]propanedioic acid |
|---|---|
| PubChem CID | 10929612 |
| Molecular Formula | C28H34N2O9 |
| Molecular Weight | 542.59 g/mol |
| Exact Mass | 542.23 |
| IUPAC Name | 2-[4-[(2S)-3-oxo-2-[(4-oxo-4-phenylmethoxybutanoyl)amino]-3-(pentylamino)propyl]phenoxy]propanedioic acid |
| SMILES | CCCCCNC(=O)[C@H](Cc1ccc(OC(C(=O)O)C(=O)O)cc1)NC(=O)CCC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C28H34N2O9/c1-2-3-7-16-29-26(33)22(17-19-10-12-21(13-11-19)39-25(27(34)35)28(36)37)30-23(31)14-15-24(32)38-18-20-8-5-4-6-9-20/h4-6,8-13,22,25H,2-3,7,14-18H2,1H3,(H,29,33)(H,30,31)(H,34,35)(H,36,37)/t22-/m0/s1 |
| InChIKey | OMVBRJMRXURCLO-QFIPXVFZSA-N |
| XLogP | 2.46 |
| TPSA | 168.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.59 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|