C22H30N2O9 — CID 18476962
2-[4-[2-(3-carboxypropanoylamino)-3-oxo-3-(pentylamino)propyl]phenoxy]butanedioic acid (PubChem CID 18476962) has the molecular formula C22H30N2O9 and a molecular weight of 466.49 g/mol. Its IUPAC name is 2-[4-[2-(3-carboxypropanoylamino)-3-oxo-3-(pentylamino)propyl]phenoxy]butanedioic acid.
| Compound Name | 2-[4-[2-(3-carboxypropanoylamino)-3-oxo-3-(pentylamino)propyl]phenoxy]butanedioic acid |
|---|---|
| PubChem CID | 18476962 |
| Molecular Formula | C22H30N2O9 |
| Molecular Weight | 466.49 g/mol |
| Exact Mass | 466.20 |
| IUPAC Name | 2-[4-[2-(3-carboxypropanoylamino)-3-oxo-3-(pentylamino)propyl]phenoxy]butanedioic acid |
| SMILES | CCCCCNC(=O)C(Cc1ccc(OC(CC(=O)O)C(=O)O)cc1)NC(=O)CCC(=O)O |
| InChI | InChI=1S/C22H30N2O9/c1-2-3-4-11-23-21(30)16(24-18(25)9-10-19(26)27)12-14-5-7-15(8-6-14)33-17(22(31)32)13-20(28)29/h5-8,16-17H,2-4,9-13H2,1H3,(H,23,30)(H,24,25)(H,26,27)(H,28,29)(H,31,32) |
| InChIKey | JQEOIKODJAHHEG-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 179.33 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.49 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|