C21H28N2O9 — CID 70277503
2-[4-[2-[(3-carboxy-3-oxopropyl)amino]-3-oxo-3-(pentylamino)propyl]phenoxy]propanedioic acid (PubChem CID 70277503) has the molecular formula C21H28N2O9 and a molecular weight of 452.46 g/mol. Its IUPAC name is 2-[4-[2-[(3-carboxy-3-oxopropyl)amino]-3-oxo-3-(pentylamino)propyl]phenoxy]propanedioic acid.
| Compound Name | 2-[4-[2-[(3-carboxy-3-oxopropyl)amino]-3-oxo-3-(pentylamino)propyl]phenoxy]propanedioic acid |
|---|---|
| PubChem CID | 70277503 |
| Molecular Formula | C21H28N2O9 |
| Molecular Weight | 452.46 g/mol |
| Exact Mass | 452.18 |
| IUPAC Name | 2-[4-[2-[(3-carboxy-3-oxopropyl)amino]-3-oxo-3-(pentylamino)propyl]phenoxy]propanedioic acid |
| SMILES | CCCCCNC(=O)C(Cc1ccc(OC(C(=O)O)C(=O)O)cc1)NCCC(=O)C(=O)O |
| InChI | InChI=1S/C21H28N2O9/c1-2-3-4-10-23-18(25)15(22-11-9-16(24)19(26)27)12-13-5-7-14(8-6-13)32-17(20(28)29)21(30)31/h5-8,15,17,22H,2-4,9-12H2,1H3,(H,23,25)(H,26,27)(H,28,29)(H,30,31) |
| InChIKey | NXPBNFJNZZRIEK-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 179.33 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.46 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|