C27H36N2O9 — CID 18476811
2-[4-[2-[(3-carboxybicyclo[2.2.2]octane-2-carbonyl)amino]-3-oxo-3-(pentylamino)propyl]phenoxy]propanedioic acid (PubChem CID 18476811) has the molecular formula C27H36N2O9 and a molecular weight of 532.59 g/mol. Its IUPAC name is 2-[4-[2-[(3-carboxybicyclo[2.2.2]octane-2-carbonyl)amino]-3-oxo-3-(pentylamino)propyl]phenoxy]propanedioic acid.
| Compound Name | 2-[4-[2-[(3-carboxybicyclo[2.2.2]octane-2-carbonyl)amino]-3-oxo-3-(pentylamino)propyl]phenoxy]propanedioic acid |
|---|---|
| PubChem CID | 18476811 |
| Molecular Formula | C27H36N2O9 |
| Molecular Weight | 532.59 g/mol |
| Exact Mass | 532.24 |
| IUPAC Name | 2-[4-[2-[(3-carboxybicyclo[2.2.2]octane-2-carbonyl)amino]-3-oxo-3-(pentylamino)propyl]phenoxy]propanedioic acid |
| SMILES | CCCCCNC(=O)C(Cc1ccc(OC(C(=O)O)C(=O)O)cc1)NC(=O)C1C2CCC(CC2)C1C(=O)O |
| InChI | InChI=1S/C27H36N2O9/c1-2-3-4-13-28-23(30)19(14-15-5-11-18(12-6-15)38-22(26(34)35)27(36)37)29-24(31)20-16-7-9-17(10-8-16)21(20)25(32)33/h5-6,11-12,16-17,19-22H,2-4,7-10,13-14H2,1H3,(H,28,30)(H,29,31)(H,32,33)(H,34,35)(H,36,37) |
| InChIKey | DJTWKSJBUFFXCP-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 179.33 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.59 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|