C36H43N3O9 — CID 18476902
2-[4-[2-[[benzyl-(1-carboxy-4-phenylbutan-2-yl)carbamoyl]amino]-3-oxo-3-(pentylamino)propyl]phenoxy]propanedioic acid (PubChem CID 18476902) has the molecular formula C36H43N3O9 and a molecular weight of 661.75 g/mol. Its IUPAC name is 2-[4-[2-[[benzyl-(1-carboxy-4-phenylbutan-2-yl)carbamoyl]amino]-3-oxo-3-(pentylamino)propyl]phenoxy]propanedioic acid.
| Compound Name | 2-[4-[2-[[benzyl-(1-carboxy-4-phenylbutan-2-yl)carbamoyl]amino]-3-oxo-3-(pentylamino)propyl]phenoxy]propanedioic acid |
|---|---|
| PubChem CID | 18476902 |
| Molecular Formula | C36H43N3O9 |
| Molecular Weight | 661.75 g/mol |
| Exact Mass | 661.30 |
| IUPAC Name | 2-[4-[2-[[benzyl-(1-carboxy-4-phenylbutan-2-yl)carbamoyl]amino]-3-oxo-3-(pentylamino)propyl]phenoxy]propanedioic acid |
| SMILES | CCCCCNC(=O)C(Cc1ccc(OC(C(=O)O)C(=O)O)cc1)NC(=O)N(Cc1ccccc1)C(CCc1ccccc1)CC(=O)O |
| InChI | InChI=1S/C36H43N3O9/c1-2-3-10-21-37-33(42)30(22-26-16-19-29(20-17-26)48-32(34(43)44)35(45)46)38-36(47)39(24-27-13-8-5-9-14-27)28(23-31(40)41)18-15-25-11-6-4-7-12-25/h4-9,11-14,16-17,19-20,28,30,32H,2-3,10,15,18,21-24H2,1H3,(H,37,42)(H,38,47)(H,40,41)(H,43,44)(H,45,46) |
| InChIKey | JMLUPOXJMPSEKA-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 182.57 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.75 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|