C23H30N2O11 — CID 18476766
3-[[3-[4-(dicarboxymethoxy)phenyl]-1-oxo-1-(pentylamino)propan-2-yl]carbamoyl]pentanedioic acid (PubChem CID 18476766) has the molecular formula C23H30N2O11 and a molecular weight of 510.50 g/mol. Its IUPAC name is 3-[[3-[4-(dicarboxymethoxy)phenyl]-1-oxo-1-(pentylamino)propan-2-yl]carbamoyl]pentanedioic acid.
| Compound Name | 3-[[3-[4-(dicarboxymethoxy)phenyl]-1-oxo-1-(pentylamino)propan-2-yl]carbamoyl]pentanedioic acid |
|---|---|
| PubChem CID | 18476766 |
| Molecular Formula | C23H30N2O11 |
| Molecular Weight | 510.50 g/mol |
| Exact Mass | 510.18 |
| IUPAC Name | 3-[[3-[4-(dicarboxymethoxy)phenyl]-1-oxo-1-(pentylamino)propan-2-yl]carbamoyl]pentanedioic acid |
| SMILES | CCCCCNC(=O)C(Cc1ccc(OC(C(=O)O)C(=O)O)cc1)NC(=O)C(CC(=O)O)CC(=O)O |
| InChI | InChI=1S/C23H30N2O11/c1-2-3-4-9-24-21(31)16(25-20(30)14(11-17(26)27)12-18(28)29)10-13-5-7-15(8-6-13)36-19(22(32)33)23(34)35/h5-8,14,16,19H,2-4,9-12H2,1H3,(H,24,31)(H,25,30)(H,26,27)(H,28,29)(H,32,33)(H,34,35) |
| InChIKey | KQVXABIZMORFHY-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 216.63 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.50 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|