C30H36N2O11 — CID 59878907
2-[[4-[3-[[(2S)-3-[4-(dicarboxymethoxy)phenyl]-1-oxo-1-(pentylamino)propan-2-yl]amino]-3-oxopropyl]phenyl]methyl]propanedioic acid (PubChem CID 59878907) has the molecular formula C30H36N2O11 and a molecular weight of 600.62 g/mol. Its IUPAC name is 2-[[4-[3-[[(2S)-3-[4-(dicarboxymethoxy)phenyl]-1-oxo-1-(pentylamino)propan-2-yl]amino]-3-oxopropyl]phenyl]methyl]propanedioic acid.
| Compound Name | 2-[[4-[3-[[(2S)-3-[4-(dicarboxymethoxy)phenyl]-1-oxo-1-(pentylamino)propan-2-yl]amino]-3-oxopropyl]phenyl]methyl]propanedioic acid |
|---|---|
| PubChem CID | 59878907 |
| Molecular Formula | C30H36N2O11 |
| Molecular Weight | 600.62 g/mol |
| Exact Mass | 600.23 |
| IUPAC Name | 2-[[4-[3-[[(2S)-3-[4-(dicarboxymethoxy)phenyl]-1-oxo-1-(pentylamino)propan-2-yl]amino]-3-oxopropyl]phenyl]methyl]propanedioic acid |
| SMILES | CCCCCNC(=O)[C@H](Cc1ccc(OC(C(=O)O)C(=O)O)cc1)NC(=O)CCc1ccc(CC(C(=O)O)C(=O)O)cc1 |
| InChI | InChI=1S/C30H36N2O11/c1-2-3-4-15-31-26(34)23(17-20-9-12-21(13-10-20)43-25(29(39)40)30(41)42)32-24(33)14-11-18-5-7-19(8-6-18)16-22(27(35)36)28(37)38/h5-10,12-13,22-23,25H,2-4,11,14-17H2,1H3,(H,31,34)(H,32,33)(H,35,36)(H,37,38)(H,39,40)(H,41,42)/t23-/m0/s1 |
| InChIKey | WVRXJFLZXPHBTF-QHCPKHFHSA-N |
| XLogP | 1.90 |
| TPSA | 216.63 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.62 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|