C22H28N2O8 — CID 10895614
2-[[4-[(2S)-2-(3-carboxypropanoylamino)-3-oxo-3-(pentylamino)propyl]phenyl]methylidene]propanedioic acid (PubChem CID 10895614) has the molecular formula C22H28N2O8 and a molecular weight of 448.47 g/mol. Its IUPAC name is 2-[[4-[(2S)-2-(3-carboxypropanoylamino)-3-oxo-3-(pentylamino)propyl]phenyl]methylidene]propanedioic acid.
| Compound Name | 2-[[4-[(2S)-2-(3-carboxypropanoylamino)-3-oxo-3-(pentylamino)propyl]phenyl]methylidene]propanedioic acid |
|---|---|
| PubChem CID | 10895614 |
| Molecular Formula | C22H28N2O8 |
| Molecular Weight | 448.47 g/mol |
| Exact Mass | 448.18 |
| IUPAC Name | 2-[[4-[(2S)-2-(3-carboxypropanoylamino)-3-oxo-3-(pentylamino)propyl]phenyl]methylidene]propanedioic acid |
| SMILES | CCCCCNC(=O)[C@H](Cc1ccc(C=C(C(=O)O)C(=O)O)cc1)NC(=O)CCC(=O)O |
| InChI | InChI=1S/C22H28N2O8/c1-2-3-4-11-23-20(28)17(24-18(25)9-10-19(26)27)13-15-7-5-14(6-8-15)12-16(21(29)30)22(31)32/h5-8,12,17H,2-4,9-11,13H2,1H3,(H,23,28)(H,24,25)(H,26,27)(H,29,30)(H,31,32)/t17-/m0/s1 |
| InChIKey | CLMCAJVBLXHSQD-KRWDZBQOSA-N |
| XLogP | 1.44 |
| TPSA | 170.10 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.47 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|