C18H27N5O4 — CID 11632251
4-[[1-[4-(diaminomethylideneamino)butylamino]-1-oxo-3-phenylpropan-2-yl]amino]-4-oxobutanoic acid (PubChem CID 11632251) has the molecular formula C18H27N5O4 and a molecular weight of 377.45 g/mol. Its IUPAC name is 4-[[1-[4-(diaminomethylideneamino)butylamino]-1-oxo-3-phenylpropan-2-yl]amino]-4-oxobutanoic acid.
| Compound Name | 4-[[1-[4-(diaminomethylideneamino)butylamino]-1-oxo-3-phenylpropan-2-yl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 11632251 |
| Molecular Formula | C18H27N5O4 |
| Molecular Weight | 377.45 g/mol |
| Exact Mass | 377.21 |
| IUPAC Name | 4-[[1-[4-(diaminomethylideneamino)butylamino]-1-oxo-3-phenylpropan-2-yl]amino]-4-oxobutanoic acid |
| SMILES | NC(N)=NCCCCNC(=O)C(Cc1ccccc1)NC(=O)CCC(=O)O |
| InChI | InChI=1S/C18H27N5O4/c19-18(20)22-11-5-4-10-21-17(27)14(12-13-6-2-1-3-7-13)23-15(24)8-9-16(25)26/h1-3,6-7,14H,4-5,8-12H2,(H,21,27)(H,23,24)(H,25,26)(H4,19,20,22) |
| InChIKey | PUBQZHQXEOLJQJ-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 159.90 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.45 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|