C25H45N7O2 — CID 54581604
N-[1-[4-(3-aminopropylamino)butylamino]-1-oxo-4-phenylbutan-2-yl]-7-(diaminomethylideneamino)heptanamide (PubChem CID 54581604) has the molecular formula C25H45N7O2 and a molecular weight of 475.68 g/mol. Its IUPAC name is N-[1-[4-(3-aminopropylamino)butylamino]-1-oxo-4-phenylbutan-2-yl]-7-(diaminomethylideneamino)heptanamide.
| Compound Name | N-[1-[4-(3-aminopropylamino)butylamino]-1-oxo-4-phenylbutan-2-yl]-7-(diaminomethylideneamino)heptanamide |
|---|---|
| PubChem CID | 54581604 |
| Molecular Formula | C25H45N7O2 |
| Molecular Weight | 475.68 g/mol |
| Exact Mass | 475.36 |
| IUPAC Name | N-[1-[4-(3-aminopropylamino)butylamino]-1-oxo-4-phenylbutan-2-yl]-7-(diaminomethylideneamino)heptanamide |
| SMILES | NCCCNCCCCNC(=O)C(CCc1ccccc1)NC(=O)CCCCCCN=C(N)N |
| InChI | InChI=1S/C25H45N7O2/c26-16-10-18-29-17-8-9-19-30-24(34)22(15-14-21-11-4-3-5-12-21)32-23(33)13-6-1-2-7-20-31-25(27)28/h3-5,11-12,22,29H,1-2,6-10,13-20,26H2,(H,30,34)(H,32,33)(H4,27,28,31) |
| InChIKey | CXCMVACZRQLRBE-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 160.65 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.68 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|