C23H31N5O3 — CID 70277936
(2R)-5-(diaminomethylideneamino)-N-[(4-hydroxyphenyl)methyl]-2-(4-phenylbutanoylamino)pentanamide (PubChem CID 70277936) has the molecular formula C23H31N5O3 and a molecular weight of 425.53 g/mol. Its IUPAC name is (2R)-5-(diaminomethylideneamino)-N-[(4-hydroxyphenyl)methyl]-2-(4-phenylbutanoylamino)pentanamide.
| Compound Name | (2R)-5-(diaminomethylideneamino)-N-[(4-hydroxyphenyl)methyl]-2-(4-phenylbutanoylamino)pentanamide |
|---|---|
| PubChem CID | 70277936 |
| Molecular Formula | C23H31N5O3 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.24 |
| IUPAC Name | (2R)-5-(diaminomethylideneamino)-N-[(4-hydroxyphenyl)methyl]-2-(4-phenylbutanoylamino)pentanamide |
| SMILES | NC(N)=NCCC[C@@H](NC(=O)CCCc1ccccc1)C(=O)NCc1ccc(O)cc1 |
| InChI | InChI=1S/C23H31N5O3/c24-23(25)26-15-5-9-20(22(31)27-16-18-11-13-19(29)14-12-18)28-21(30)10-4-8-17-6-2-1-3-7-17/h1-3,6-7,11-14,20,29H,4-5,8-10,15-16H2,(H,27,31)(H,28,30)(H4,24,25,26)/t20-/m1/s1 |
| InChIKey | KXPGKVOJNBUPHX-HXUWFJFHSA-N |
| XLogP | 1.57 |
| TPSA | 142.83 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|