C33H35N5O3 — CID 70279694
(2R)-5-(diaminomethylideneamino)-N-[(4-hydroxyphenyl)methyl]-2-[(2,2,2-triphenylacetyl)amino]pentanamide (PubChem CID 70279694) has the molecular formula C33H35N5O3 and a molecular weight of 549.68 g/mol. Its IUPAC name is (2R)-5-(diaminomethylideneamino)-N-[(4-hydroxyphenyl)methyl]-2-[(2,2,2-triphenylacetyl)amino]pentanamide.
| Compound Name | (2R)-5-(diaminomethylideneamino)-N-[(4-hydroxyphenyl)methyl]-2-[(2,2,2-triphenylacetyl)amino]pentanamide |
|---|---|
| PubChem CID | 70279694 |
| Molecular Formula | C33H35N5O3 |
| Molecular Weight | 549.68 g/mol |
| Exact Mass | 549.27 |
| IUPAC Name | (2R)-5-(diaminomethylideneamino)-N-[(4-hydroxyphenyl)methyl]-2-[(2,2,2-triphenylacetyl)amino]pentanamide |
| SMILES | NC(N)=NCCC[C@@H](NC(=O)C(c1ccccc1)(c1ccccc1)c1ccccc1)C(=O)NCc1ccc(O)cc1 |
| InChI | InChI=1S/C33H35N5O3/c34-32(35)36-22-10-17-29(30(40)37-23-24-18-20-28(39)21-19-24)38-31(41)33(25-11-4-1-5-12-25,26-13-6-2-7-14-26)27-15-8-3-9-16-27/h1-9,11-16,18-21,29,39H,10,17,22-23H2,(H,37,40)(H,38,41)(H4,34,35,36)/t29-/m1/s1 |
| InChIKey | FORXEYGGFIIWAW-GDLZYMKVSA-N |
| XLogP | 3.58 |
| TPSA | 142.83 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.68 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|