C29H42N6O3 — CID 176814317
(2R)-5-(diaminomethylideneamino)-N-[(4-hydroxyphenyl)methyl]-2-[[(2R)-2-phenyl-2-(4-propylpiperidin-1-yl)acetyl]amino]pentanamide (PubChem CID 176814317) has the molecular formula C29H42N6O3 and a molecular weight of 522.69 g/mol. Its IUPAC name is (2R)-5-(diaminomethylideneamino)-N-[(4-hydroxyphenyl)methyl]-2-[[(2R)-2-phenyl-2-(4-propylpiperidin-1-yl)acetyl]amino]pentanamide.
| Compound Name | (2R)-5-(diaminomethylideneamino)-N-[(4-hydroxyphenyl)methyl]-2-[[(2R)-2-phenyl-2-(4-propylpiperidin-1-yl)acetyl]amino]pentanamide |
|---|---|
| PubChem CID | 176814317 |
| Molecular Formula | C29H42N6O3 |
| Molecular Weight | 522.69 g/mol |
| Exact Mass | 522.33 |
| IUPAC Name | (2R)-5-(diaminomethylideneamino)-N-[(4-hydroxyphenyl)methyl]-2-[[(2R)-2-phenyl-2-(4-propylpiperidin-1-yl)acetyl]amino]pentanamide |
| SMILES | CCCC1CCN([C@@H](C(=O)N[C@H](CCCN=C(N)N)C(=O)NCc2ccc(O)cc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C29H42N6O3/c1-2-7-21-15-18-35(19-16-21)26(23-8-4-3-5-9-23)28(38)34-25(10-6-17-32-29(30)31)27(37)33-20-22-11-13-24(36)14-12-22/h3-5,8-9,11-14,21,25-26,36H,2,6-7,10,15-20H2,1H3,(H,33,37)(H,34,38)(H4,30,31,32)/t25-,26-/m1/s1 |
| InChIKey | AVPJTYKITQVPCA-CLJLJLNGSA-N |
| XLogP | 2.80 |
| TPSA | 146.07 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.69 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|