C27H32N6O4S — CID 69129765
(2R)-5-(diaminomethylideneamino)-2-[(2,2-diphenylacetyl)amino]-N-[(4-sulfamoylphenyl)methyl]pentanamide (PubChem CID 69129765) has the molecular formula C27H32N6O4S and a molecular weight of 536.66 g/mol. Its IUPAC name is (2R)-5-(diaminomethylideneamino)-2-[(2,2-diphenylacetyl)amino]-N-[(4-sulfamoylphenyl)methyl]pentanamide.
| Compound Name | (2R)-5-(diaminomethylideneamino)-2-[(2,2-diphenylacetyl)amino]-N-[(4-sulfamoylphenyl)methyl]pentanamide |
|---|---|
| PubChem CID | 69129765 |
| Molecular Formula | C27H32N6O4S |
| Molecular Weight | 536.66 g/mol |
| Exact Mass | 536.22 |
| IUPAC Name | (2R)-5-(diaminomethylideneamino)-2-[(2,2-diphenylacetyl)amino]-N-[(4-sulfamoylphenyl)methyl]pentanamide |
| SMILES | NC(N)=NCCC[C@@H](NC(=O)C(c1ccccc1)c1ccccc1)C(=O)NCc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C27H32N6O4S/c28-27(29)31-17-7-12-23(25(34)32-18-19-13-15-22(16-14-19)38(30,36)37)33-26(35)24(20-8-3-1-4-9-20)21-10-5-2-6-11-21/h1-6,8-11,13-16,23-24H,7,12,17-18H2,(H,32,34)(H,33,35)(H4,28,29,31)(H2,30,36,37)/t23-/m1/s1 |
| InChIKey | FXNVMVSAARLYPR-HSZRJFAPSA-N |
| XLogP | 1.32 |
| TPSA | 182.76 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.66 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|