C29H33N5O5 — CID 15338882
methyl N-[N'-[(4R)-4-[(2,2-diphenylacetyl)amino]-5-[(4-hydroxyphenyl)methylamino]-5-oxopentyl]carbamimidoyl]carbamate (PubChem CID 15338882) has the molecular formula C29H33N5O5 and a molecular weight of 531.61 g/mol. Its IUPAC name is methyl N-[N'-[(4R)-4-[(2,2-diphenylacetyl)amino]-5-[(4-hydroxyphenyl)methylamino]-5-oxopentyl]carbamimidoyl]carbamate.
| Compound Name | methyl N-[N'-[(4R)-4-[(2,2-diphenylacetyl)amino]-5-[(4-hydroxyphenyl)methylamino]-5-oxopentyl]carbamimidoyl]carbamate |
|---|---|
| PubChem CID | 15338882 |
| Molecular Formula | C29H33N5O5 |
| Molecular Weight | 531.61 g/mol |
| Exact Mass | 531.25 |
| IUPAC Name | methyl N-[N'-[(4R)-4-[(2,2-diphenylacetyl)amino]-5-[(4-hydroxyphenyl)methylamino]-5-oxopentyl]carbamimidoyl]carbamate |
| SMILES | COC(=O)N/C(N)=N/CCC[C@@H](NC(=O)C(c1ccccc1)c1ccccc1)C(=O)NCc1ccc(O)cc1 |
| InChI | InChI=1S/C29H33N5O5/c1-39-29(38)34-28(30)31-18-8-13-24(26(36)32-19-20-14-16-23(35)17-15-20)33-27(37)25(21-9-4-2-5-10-21)22-11-6-3-7-12-22/h2-7,9-12,14-17,24-25,35H,8,13,18-19H2,1H3,(H,32,36)(H,33,37)(H3,30,31,34,38)/t24-/m1/s1 |
| InChIKey | RCEPKPUPTVYQJA-XMMPIXPASA-N |
| XLogP | 2.78 |
| TPSA | 155.14 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.61 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|