C34H45N7O5 — CID 171639922
(2R)-2-[[2-[3-(4-aminobutoxy)phenyl]-2-phenylacetyl]amino]-5-[[amino-(ethylcarbamoylamino)methylidene]amino]-N-[(4-hydroxyphenyl)methyl]pentanamide (PubChem CID 171639922) has the molecular formula C34H45N7O5 and a molecular weight of 631.78 g/mol. Its IUPAC name is (2R)-2-[[2-[3-(4-aminobutoxy)phenyl]-2-phenylacetyl]amino]-5-[[amino-(ethylcarbamoylamino)methylidene]amino]-N-[(4-hydroxyphenyl)methyl]pentanamide.
| Compound Name | (2R)-2-[[2-[3-(4-aminobutoxy)phenyl]-2-phenylacetyl]amino]-5-[[amino-(ethylcarbamoylamino)methylidene]amino]-N-[(4-hydroxyphenyl)methyl]pentanamide |
|---|---|
| PubChem CID | 171639922 |
| Molecular Formula | C34H45N7O5 |
| Molecular Weight | 631.78 g/mol |
| Exact Mass | 631.35 |
| IUPAC Name | (2R)-2-[[2-[3-(4-aminobutoxy)phenyl]-2-phenylacetyl]amino]-5-[[amino-(ethylcarbamoylamino)methylidene]amino]-N-[(4-hydroxyphenyl)methyl]pentanamide |
| SMILES | CCNC(=O)N/C(N)=N/CCC[C@@H](NC(=O)C(c1ccccc1)c1cccc(OCCCCN)c1)C(=O)NCc1ccc(O)cc1 |
| InChI | InChI=1S/C34H45N7O5/c1-2-37-34(45)41-33(36)38-20-9-14-29(31(43)39-23-24-15-17-27(42)18-16-24)40-32(44)30(25-10-4-3-5-11-25)26-12-8-13-28(22-26)46-21-7-6-19-35/h3-5,8,10-13,15-18,22,29-30,42H,2,6-7,9,14,19-21,23,35H2,1H3,(H,39,43)(H,40,44)(H4,36,37,38,41,45)/t29-,30?/m1/s1 |
| InChIKey | KMZUUAOTEWDBDZ-IDCGIGBZSA-N |
| XLogP | 2.86 |
| TPSA | 193.19 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.78 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|