C44H47N7O5 — CID 162648914
(2R)-5-[[amino-[2-[(2,2-diphenylacetyl)amino]ethylcarbamoylamino]methylidene]amino]-2-[(2,2-diphenylacetyl)amino]-N-[(4-hydroxyphenyl)methyl]pentanamide (PubChem CID 162648914) has the molecular formula C44H47N7O5 and a molecular weight of 753.90 g/mol. Its IUPAC name is (2R)-5-[[amino-[2-[(2,2-diphenylacetyl)amino]ethylcarbamoylamino]methylidene]amino]-2-[(2,2-diphenylacetyl)amino]-N-[(4-hydroxyphenyl)methyl]pentanamide.
| Compound Name | (2R)-5-[[amino-[2-[(2,2-diphenylacetyl)amino]ethylcarbamoylamino]methylidene]amino]-2-[(2,2-diphenylacetyl)amino]-N-[(4-hydroxyphenyl)methyl]pentanamide |
|---|---|
| PubChem CID | 162648914 |
| Molecular Formula | C44H47N7O5 |
| Molecular Weight | 753.90 g/mol |
| Exact Mass | 753.36 |
| IUPAC Name | (2R)-5-[[amino-[2-[(2,2-diphenylacetyl)amino]ethylcarbamoylamino]methylidene]amino]-2-[(2,2-diphenylacetyl)amino]-N-[(4-hydroxyphenyl)methyl]pentanamide |
| SMILES | N/C(=N\CCC[C@@H](NC(=O)C(c1ccccc1)c1ccccc1)C(=O)NCc1ccc(O)cc1)NC(=O)NCCNC(=O)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C44H47N7O5/c45-43(51-44(56)48-29-28-46-41(54)38(32-14-5-1-6-15-32)33-16-7-2-8-17-33)47-27-13-22-37(40(53)49-30-31-23-25-36(52)26-24-31)50-42(55)39(34-18-9-3-10-19-34)35-20-11-4-12-21-35/h1-12,14-21,23-26,37-39,52H,13,22,27-30H2,(H,46,54)(H,49,53)(H,50,55)(H4,45,47,48,51,56)/t37-/m1/s1 |
| InChIKey | GVUHZUXDTVCYKG-DIPNUNPCSA-N |
| XLogP | 4.67 |
| TPSA | 187.04 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 753.90 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|