C35H45N7O5 — CID 54273169
N-[[4-(acetamidomethyl)phenyl]methyl]-5-[[amino-(2-ethoxyethylcarbamoylamino)methylidene]amino]-2-[(2,2-diphenylacetyl)amino]pentanamide (PubChem CID 54273169) has the molecular formula C35H45N7O5 and a molecular weight of 643.79 g/mol. Its IUPAC name is N-[[4-(acetamidomethyl)phenyl]methyl]-5-[[amino-(2-ethoxyethylcarbamoylamino)methylidene]amino]-2-[(2,2-diphenylacetyl)amino]pentanamide.
| Compound Name | N-[[4-(acetamidomethyl)phenyl]methyl]-5-[[amino-(2-ethoxyethylcarbamoylamino)methylidene]amino]-2-[(2,2-diphenylacetyl)amino]pentanamide |
|---|---|
| PubChem CID | 54273169 |
| Molecular Formula | C35H45N7O5 |
| Molecular Weight | 643.79 g/mol |
| Exact Mass | 643.35 |
| IUPAC Name | N-[[4-(acetamidomethyl)phenyl]methyl]-5-[[amino-(2-ethoxyethylcarbamoylamino)methylidene]amino]-2-[(2,2-diphenylacetyl)amino]pentanamide |
| SMILES | CCOCCNC(=O)N/C(N)=N/CCCC(NC(=O)C(c1ccccc1)c1ccccc1)C(=O)NCc1ccc(CNC(C)=O)cc1 |
| InChI | InChI=1S/C35H45N7O5/c1-3-47-22-21-38-35(46)42-34(36)37-20-10-15-30(32(44)40-24-27-18-16-26(17-19-27)23-39-25(2)43)41-33(45)31(28-11-6-4-7-12-28)29-13-8-5-9-14-29/h4-9,11-14,16-19,30-31H,3,10,15,20-24H2,1-2H3,(H,39,43)(H,40,44)(H,41,45)(H4,36,37,38,42,46) |
| InChIKey | RLPBHBRDWOHNPN-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 176.04 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.79 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|