C31H37N7O5 — CID 54451785
[4-[[[5-[[amino-(methylcarbamoylamino)methylidene]amino]-2-[(2,2-diphenylacetyl)amino]pentanoyl]amino]methyl]phenyl] N-methylcarbamate (PubChem CID 54451785) has the molecular formula C31H37N7O5 and a molecular weight of 587.68 g/mol. Its IUPAC name is [4-[[[5-[[amino-(methylcarbamoylamino)methylidene]amino]-2-[(2,2-diphenylacetyl)amino]pentanoyl]amino]methyl]phenyl] N-methylcarbamate.
| Compound Name | [4-[[[5-[[amino-(methylcarbamoylamino)methylidene]amino]-2-[(2,2-diphenylacetyl)amino]pentanoyl]amino]methyl]phenyl] N-methylcarbamate |
|---|---|
| PubChem CID | 54451785 |
| Molecular Formula | C31H37N7O5 |
| Molecular Weight | 587.68 g/mol |
| Exact Mass | 587.29 |
| IUPAC Name | [4-[[[5-[[amino-(methylcarbamoylamino)methylidene]amino]-2-[(2,2-diphenylacetyl)amino]pentanoyl]amino]methyl]phenyl] N-methylcarbamate |
| SMILES | CNC(=O)N/C(N)=N/CCCC(NC(=O)C(c1ccccc1)c1ccccc1)C(=O)NCc1ccc(OC(=O)NC)cc1 |
| InChI | InChI=1S/C31H37N7O5/c1-33-30(41)38-29(32)35-19-9-14-25(27(39)36-20-21-15-17-24(18-16-21)43-31(42)34-2)37-28(40)26(22-10-5-3-6-11-22)23-12-7-4-8-13-23/h3-8,10-13,15-18,25-26H,9,14,19-20H2,1-2H3,(H,34,42)(H,36,39)(H,37,40)(H4,32,33,35,38,41) |
| InChIKey | WVLSUAQQDMPPQA-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 176.04 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.68 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|