C32H39N9O4 — CID 162328795
acetic acid;(2R)-N-[[4-[[[amino-(cyanoamino)methylidene]amino]methyl]phenyl]methyl]-5-(diaminomethylideneamino)-2-[(2,2-diphenylacetyl)amino]pentanamide (PubChem CID 162328795) has the molecular formula C32H39N9O4 and a molecular weight of 613.72 g/mol. Its IUPAC name is acetic acid;(2R)-N-[[4-[[[amino-(cyanoamino)methylidene]amino]methyl]phenyl]methyl]-5-(diaminomethylideneamino)-2-[(2,2-diphenylacetyl)amino]pentanamide.
| Compound Name | acetic acid;(2R)-N-[[4-[[[amino-(cyanoamino)methylidene]amino]methyl]phenyl]methyl]-5-(diaminomethylideneamino)-2-[(2,2-diphenylacetyl)amino]pentanamide |
|---|---|
| PubChem CID | 162328795 |
| Molecular Formula | C32H39N9O4 |
| Molecular Weight | 613.72 g/mol |
| Exact Mass | 613.31 |
| IUPAC Name | acetic acid;(2R)-N-[[4-[[[amino-(cyanoamino)methylidene]amino]methyl]phenyl]methyl]-5-(diaminomethylideneamino)-2-[(2,2-diphenylacetyl)amino]pentanamide |
| SMILES | CC(=O)O.N#CN/C(N)=N/Cc1ccc(CNC(=O)[C@@H](CCCN=C(N)N)NC(=O)C(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C30H35N9O2.C2H4O2/c31-20-38-30(34)37-19-22-15-13-21(14-16-22)18-36-27(40)25(12-7-17-35-29(32)33)39-28(41)26(23-8-3-1-4-9-23)24-10-5-2-6-11-24;1-2(3)4/h1-6,8-11,13-16,25-26H,7,12,17-19H2,(H,36,40)(H,39,41)(H4,32,33,35)(H3,34,37,38);1H3,(H,3,4)/t25-;/m1./s1 |
| InChIKey | XONPBKFVZURSEL-VQIWEWKSSA-N |
| XLogP | 1.65 |
| TPSA | 234.10 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.72 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|