C20H25N5O2 — CID 18357243
5-(diaminomethylideneamino)-2-[(2,2-diphenylacetyl)amino]pentanamide (PubChem CID 18357243) has the molecular formula C20H25N5O2 and a molecular weight of 367.45 g/mol. Its IUPAC name is 5-(diaminomethylideneamino)-2-[(2,2-diphenylacetyl)amino]pentanamide.
| Compound Name | 5-(diaminomethylideneamino)-2-[(2,2-diphenylacetyl)amino]pentanamide |
|---|---|
| PubChem CID | 18357243 |
| Molecular Formula | C20H25N5O2 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.20 |
| IUPAC Name | 5-(diaminomethylideneamino)-2-[(2,2-diphenylacetyl)amino]pentanamide |
| SMILES | NC(=O)C(CCCN=C(N)N)NC(=O)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H25N5O2/c21-18(26)16(12-7-13-24-20(22)23)25-19(27)17(14-8-3-1-4-9-14)15-10-5-2-6-11-15/h1-6,8-11,16-17H,7,12-13H2,(H2,21,26)(H,25,27)(H4,22,23,24) |
| InChIKey | CCXQVUPLCBFCCL-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 136.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|