C29H36ClN5O2 — CID 141009397
(2R)-5-(diaminomethylideneamino)-2-[(2,2-diphenylacetyl)amino]-N-(2-phenylpropan-2-yl)pentanamide;hydrochloride (PubChem CID 141009397) has the molecular formula C29H36ClN5O2 and a molecular weight of 522.09 g/mol. Its IUPAC name is (2R)-5-(diaminomethylideneamino)-2-[(2,2-diphenylacetyl)amino]-N-(2-phenylpropan-2-yl)pentanamide;hydrochloride.
| Compound Name | (2R)-5-(diaminomethylideneamino)-2-[(2,2-diphenylacetyl)amino]-N-(2-phenylpropan-2-yl)pentanamide;hydrochloride |
|---|---|
| PubChem CID | 141009397 |
| Molecular Formula | C29H36ClN5O2 |
| Molecular Weight | 522.09 g/mol |
| Exact Mass | 521.26 |
| IUPAC Name | (2R)-5-(diaminomethylideneamino)-2-[(2,2-diphenylacetyl)amino]-N-(2-phenylpropan-2-yl)pentanamide;hydrochloride |
| SMILES | CC(C)(NC(=O)[C@@H](CCCN=C(N)N)NC(=O)C(c1ccccc1)c1ccccc1)c1ccccc1.Cl |
| InChI | InChI=1S/C29H35N5O2.ClH/c1-29(2,23-17-10-5-11-18-23)34-26(35)24(19-12-20-32-28(30)31)33-27(36)25(21-13-6-3-7-14-21)22-15-8-4-9-16-22;/h3-11,13-18,24-25H,12,19-20H2,1-2H3,(H,33,36)(H,34,35)(H4,30,31,32);1H/t24-;/m1./s1 |
| InChIKey | NGOXDDDKEBRDLI-GJFSDDNBSA-N |
| XLogP | 3.83 |
| TPSA | 122.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.09 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|