C15H25N5O — CID 139896055
(2S)-2-amino-5-(diaminomethylideneamino)-N-(2-phenylpropan-2-yl)pentanamide (PubChem CID 139896055) has the molecular formula C15H25N5O and a molecular weight of 291.40 g/mol. Its IUPAC name is (2S)-2-amino-5-(diaminomethylideneamino)-N-(2-phenylpropan-2-yl)pentanamide.
| Compound Name | (2S)-2-amino-5-(diaminomethylideneamino)-N-(2-phenylpropan-2-yl)pentanamide |
|---|---|
| PubChem CID | 139896055 |
| Molecular Formula | C15H25N5O |
| Molecular Weight | 291.40 g/mol |
| Exact Mass | 291.21 |
| IUPAC Name | (2S)-2-amino-5-(diaminomethylideneamino)-N-(2-phenylpropan-2-yl)pentanamide |
| SMILES | CC(C)(NC(=O)[C@@H](N)CCCN=C(N)N)c1ccccc1 |
| InChI | InChI=1S/C15H25N5O/c1-15(2,11-7-4-3-5-8-11)20-13(21)12(16)9-6-10-19-14(17)18/h3-5,7-8,12H,6,9-10,16H2,1-2H3,(H,20,21)(H4,17,18,19)/t12-/m0/s1 |
| InChIKey | LZCRZDVYRVSEDP-LBPRGKRZSA-N |
| XLogP | 0.42 |
| TPSA | 119.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.40 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|